C35H56O7 — CID 59957418
(4,4-dimethyl-2-oxooxolan-3-yl) 4-[(3S,7R,10S,13R)-7-hydroxy-10,13-dimethyl-3-(2-methylbutanoyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 59957418) has the molecular formula C35H56O7 and a molecular weight of 588.83 g/mol. Its IUPAC name is (4,4-dimethyl-2-oxooxolan-3-yl) 4-[(3S,7R,10S,13R)-7-hydroxy-10,13-dimethyl-3-(2-methylbutanoyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | (4,4-dimethyl-2-oxooxolan-3-yl) 4-[(3S,7R,10S,13R)-7-hydroxy-10,13-dimethyl-3-(2-methylbutanoyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 59957418 |
| Molecular Formula | C35H56O7 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | (4,4-dimethyl-2-oxooxolan-3-yl) 4-[(3S,7R,10S,13R)-7-hydroxy-10,13-dimethyl-3-(2-methylbutanoyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CCC(C)C(=O)O[C@H]1CC[C@@]2(C)C(CC(O)C3C4CCC(C(C)CCC(=O)OC5C(=O)OCC5(C)C)[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C35H56O7/c1-8-20(2)31(38)41-23-13-15-34(6)22(17-23)18-27(36)29-25-11-10-24(35(25,7)16-14-26(29)34)21(3)9-12-28(37)42-30-32(39)40-19-33(30,4)5/h20-27,29-30,36H,8-19H2,1-7H3/t20?,21?,22?,23-,24?,25?,26?,27?,29?,30?,34-,35+/m0/s1 |
| InChIKey | VYIHLBFUHZFNRK-DBIQKEPXSA-N |
| XLogP | 6.49 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|