C16H19N2OW- — CID 59957632
3-(2,4-dimethylbenzene-5-id-1-yl)-1,5,6-trimethyl-2-methylidenepyrimidin-4-one;tungsten (PubChem CID 59957632) has the molecular formula C16H19N2OW- and a molecular weight of 439.18 g/mol. Its IUPAC name is 3-(2,4-dimethylbenzene-5-id-1-yl)-1,5,6-trimethyl-2-methylidenepyrimidin-4-one;tungsten.
| Compound Name | 3-(2,4-dimethylbenzene-5-id-1-yl)-1,5,6-trimethyl-2-methylidenepyrimidin-4-one;tungsten |
|---|---|
| PubChem CID | 59957632 |
| Molecular Formula | C16H19N2OW- |
| Molecular Weight | 439.18 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 3-(2,4-dimethylbenzene-5-id-1-yl)-1,5,6-trimethyl-2-methylidenepyrimidin-4-one;tungsten |
| SMILES | C=C1N(C)C(C)=C(C)C(=O)N1c1c[c-]c(C)cc1C.[W] |
| InChI | InChI=1S/C16H19N2O.W/c1-10-7-8-15(11(2)9-10)18-14(5)17(6)13(4)12(3)16(18)19;/h8-9H,5H2,1-4,6H3;/q-1; |
| InChIKey | NBOPUSZAQUTBFQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|