C15H17N2O2W- — CID 59957637
3-(2,4-dimethylbenzene-5-id-1-yl)-1,5,6-trimethylpyrimidine-2,4-dione;tungsten (PubChem CID 59957637) has the molecular formula C15H17N2O2W- and a molecular weight of 441.15 g/mol. Its IUPAC name is 3-(2,4-dimethylbenzene-5-id-1-yl)-1,5,6-trimethylpyrimidine-2,4-dione;tungsten.
| Compound Name | 3-(2,4-dimethylbenzene-5-id-1-yl)-1,5,6-trimethylpyrimidine-2,4-dione;tungsten |
|---|---|
| PubChem CID | 59957637 |
| Molecular Formula | C15H17N2O2W- |
| Molecular Weight | 441.15 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 3-(2,4-dimethylbenzene-5-id-1-yl)-1,5,6-trimethylpyrimidine-2,4-dione;tungsten |
| SMILES | Cc1[c-]cc(-n2c(=O)c(C)c(C)n(C)c2=O)c(C)c1.[W] |
| InChI | InChI=1S/C15H17N2O2.W/c1-9-6-7-13(10(2)8-9)17-14(18)11(3)12(4)16(5)15(17)19;/h7-8H,1-5H3;/q-1; |
| InChIKey | VEDIOGBWBCYZRJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|