C13H9ClF3N2O2W- — CID 59957660
3-(4-chloro-2-methylbenzene-5-id-1-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione;tungsten (PubChem CID 59957660) has the molecular formula C13H9ClF3N2O2W- and a molecular weight of 501.51 g/mol. Its IUPAC name is 3-(4-chloro-2-methylbenzene-5-id-1-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione;tungsten.
| Compound Name | 3-(4-chloro-2-methylbenzene-5-id-1-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione;tungsten |
|---|---|
| PubChem CID | 59957660 |
| Molecular Formula | C13H9ClF3N2O2W- |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | 3-(4-chloro-2-methylbenzene-5-id-1-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione;tungsten |
| SMILES | Cc1cc(Cl)[c-]cc1-n1c(=O)cc(C(F)(F)F)n(C)c1=O.[W] |
| InChI | InChI=1S/C13H9ClF3N2O2.W/c1-7-5-8(14)3-4-9(7)19-11(20)6-10(13(15,16)17)18(2)12(19)21;/h4-6H,1-2H3;/q-1; |
| InChIKey | BLGOHOYVCVNVKE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|