C25H29Br — CID 59957844
6-[(Z)-(5-bromo-2,3-dihydroinden-1-ylidene)methyl]-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene (PubChem CID 59957844) has the molecular formula C25H29Br and a molecular weight of 409.41 g/mol. Its IUPAC name is 6-[(Z)-(5-bromo-2,3-dihydroinden-1-ylidene)methyl]-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene.
| Compound Name | 6-[(Z)-(5-bromo-2,3-dihydroinden-1-ylidene)methyl]-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 59957844 |
| Molecular Formula | C25H29Br |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 6-[(Z)-(5-bromo-2,3-dihydroinden-1-ylidene)methyl]-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene |
| SMILES | Cc1cc2c(cc1/C=C1/CCc3cc(Br)ccc31)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H29Br/c1-16-12-22-23(25(4,5)11-10-24(22,2)3)15-19(16)13-17-6-7-18-14-20(26)8-9-21(17)18/h8-9,12-15H,6-7,10-11H2,1-5H3/b17-13- |
| InChIKey | KQQRQDPLHSNRPA-LGMDPLHJSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|