C18H16O5S2 — CID 59958385
2-[7-(3,4-dimethyl-1,1-dioxothiophen-2-yl)hepta-2,4,5,6-tetraenylidene]-4-methyl-1,1-dioxothiophen-3-one (PubChem CID 59958385) has the molecular formula C18H16O5S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[7-(3,4-dimethyl-1,1-dioxothiophen-2-yl)hepta-2,4,5,6-tetraenylidene]-4-methyl-1,1-dioxothiophen-3-one.
| Compound Name | 2-[7-(3,4-dimethyl-1,1-dioxothiophen-2-yl)hepta-2,4,5,6-tetraenylidene]-4-methyl-1,1-dioxothiophen-3-one |
|---|---|
| PubChem CID | 59958385 |
| Molecular Formula | C18H16O5S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-[7-(3,4-dimethyl-1,1-dioxothiophen-2-yl)hepta-2,4,5,6-tetraenylidene]-4-methyl-1,1-dioxothiophen-3-one |
| SMILES | CC1=CS(=O)(=O)C(=CC=CC=C=C=CC2=C(C)C(C)=CS2(=O)=O)C1=O |
| InChI | InChI=1S/C18H16O5S2/c1-13-11-24(20,21)16(15(13)3)9-7-5-4-6-8-10-17-18(19)14(2)12-25(17,22)23/h4,6,8-12H,1-3H3/b8-6?,9-4+,17-10? |
| InChIKey | QIPSLSAJGAMSGV-QUZPZOIASA-N |
| XLogP | 2.80 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|