About 3-ethyl-2-methylidene-1,3-thiazolidine
3-ethyl-2-methylidene-1,3-thiazolidine (PubChem CID 59958523) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is 3-ethyl-2-methylidene-1,3-thiazolidine.
Molecular Properties
| Compound Name | 3-ethyl-2-methylidene-1,3-thiazolidine |
| PubChem CID | 59958523 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 3-ethyl-2-methylidene-1,3-thiazolidine |
| SMILES | C=C1SCCN1CC |
| InChI | InChI=1S/C6H11NS/c1-3-7-4-5-8-6(7)2/h2-5H2,1H3 |
| InChIKey | OYOIWFQHYDSYKG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-2-methylidene-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-methylidene-1,3-thiazolidine?
The IUPAC name of 3-ethyl-2-methylidene-1,3-thiazolidine (CID 59958523) is 3-ethyl-2-methylidene-1,3-thiazolidine.
What is the SMILES notation for 3-ethyl-2-methylidene-1,3-thiazolidine?
The canonical SMILES for 3-ethyl-2-methylidene-1,3-thiazolidine is C=C1SCCN1CC.
What is the InChIKey of 3-ethyl-2-methylidene-1,3-thiazolidine?
The InChIKey is OYOIWFQHYDSYKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NS/c1-3-7-4-5-8-6(7)2/h2-5H2,1H3.
What are the key properties of 3-ethyl-2-methylidene-1,3-thiazolidine?
3-ethyl-2-methylidene-1,3-thiazolidine has a molecular weight of 129.23 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-methylidene-1,3-thiazolidine is sourced from PubChem (CID 59958523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).