About 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+)
2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+) (PubChem CID 59958666) has the molecular formula C23H26ClN2ORb
and a molecular weight of 467.40 g/mol. Its IUPAC name is 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+).
Molecular Properties
| Compound Name | 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+) |
| PubChem CID | 59958666 |
| Molecular Formula | C23H26ClN2ORb |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+) |
| SMILES | Clc1ccc(OCc2cc3[c-]cccc3n2CCCC2CCNCC2)cc1.[Rb+] |
| InChI | InChI=1S/C23H26ClN2O.Rb/c24-20-7-9-22(10-8-20)27-17-21-16-19-5-1-2-6-23(19)26(21)15-3-4-18-11-13-25-14-12-18;/h1-2,6-10,16,18,25H,3-4,11-15,17H2;/q-1;+1 |
| InChIKey | YVINQOOIJMBVJJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+)?
The IUPAC name of 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+) (CID 59958666) is 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+).
What is the SMILES notation for 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+)?
The canonical SMILES for 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+) is Clc1ccc(OCc2cc3[c-]cccc3n2CCCC2CCNCC2)cc1.[Rb+].
What is the InChIKey of 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+)?
The InChIKey is YVINQOOIJMBVJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26ClN2O.Rb/c24-20-7-9-22(10-8-20)27-17-21-16-19-5-1-2-6-23(19)26(21)15-3-4-18-11-13-25-14-12-18;/h1-2,6-10,16,18,25H,3-4,11-15,17H2;/q-1;+1.
What are the key properties of 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+)?
2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+) has a molecular weight of 467.40 g/mol, XLogP of 2.46, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenoxy)methyl]-1-(3-piperidin-4-ylpropyl)-4H-indol-4-ide;rubidium(1+) is sourced from PubChem (CID 59958666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).