About 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone
1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone (PubChem CID 59958766) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone |
| PubChem CID | 59958766 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone |
| SMILES | CC(=O)[C@H]1CN(C)CC1(C)C |
| InChI | InChI=1S/C9H17NO/c1-7(11)8-5-10(4)6-9(8,2)3/h8H,5-6H2,1-4H3/t8-/m1/s1 |
| InChIKey | CQPZRICAHCMILA-MRVPVSSYSA-N |
| XLogP | 1.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone?
The IUPAC name of 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone (CID 59958766) is 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone.
What is the SMILES notation for 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone?
The canonical SMILES for 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone is CC(=O)[C@H]1CN(C)CC1(C)C.
What is the InChIKey of 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone?
The InChIKey is CQPZRICAHCMILA-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H17NO/c1-7(11)8-5-10(4)6-9(8,2)3/h8H,5-6H2,1-4H3/t8-/m1/s1.
What are the key properties of 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone?
1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone has a molecular weight of 155.24 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-1,4,4-trimethylpyrrolidin-3-yl]ethanone is sourced from PubChem (CID 59958766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).