C32H41N3O2 — CID 59959049
(2R)-2-cyclohexyl-2-[(3S)-3-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid (PubChem CID 59959049) has the molecular formula C32H41N3O2 and a molecular weight of 499.70 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-2-[(3S)-3-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid.
| Compound Name | (2R)-2-cyclohexyl-2-[(3S)-3-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 59959049 |
| Molecular Formula | C32H41N3O2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | (2R)-2-cyclohexyl-2-[(3S)-3-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@@H](C1CCCCC1)N1CC(c2ccccc2)[C@@H](CN2CCC(c3c[nH]c4ccccc34)CC2)C1 |
| InChI | InChI=1S/C32H41N3O2/c36-32(37)31(25-11-5-2-6-12-25)35-21-26(29(22-35)23-9-3-1-4-10-23)20-34-17-15-24(16-18-34)28-19-33-30-14-8-7-13-27(28)30/h1,3-4,7-10,13-14,19,24-26,29,31,33H,2,5-6,11-12,15-18,20-22H2,(H,36,37)/t26-,29?,31+/m0/s1 |
| InChIKey | PXULGTAZSZWVHW-LGZOALLCSA-N |
| XLogP | 6.10 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |