C33H41F2N3O2S — CID 59959122
(2R)-2-[(3S,4S)-3-[[4-[2-[(2,4-difluorophenyl)methyl]-1,3-thiazol-5-yl]piperidin-1-yl]methyl]-4-(3-methylphenyl)pyrrolidin-1-yl]-3,3-dimethylbutanoic acid (PubChem CID 59959122) has the molecular formula C33H41F2N3O2S and a molecular weight of 581.77 g/mol. Its IUPAC name is (2R)-2-[(3S,4S)-3-[[4-[2-[(2,4-difluorophenyl)methyl]-1,3-thiazol-5-yl]piperidin-1-yl]methyl]-4-(3-methylphenyl)pyrrolidin-1-yl]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[(3S,4S)-3-[[4-[2-[(2,4-difluorophenyl)methyl]-1,3-thiazol-5-yl]piperidin-1-yl]methyl]-4-(3-methylphenyl)pyrrolidin-1-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 59959122 |
| Molecular Formula | C33H41F2N3O2S |
| Molecular Weight | 581.77 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | (2R)-2-[(3S,4S)-3-[[4-[2-[(2,4-difluorophenyl)methyl]-1,3-thiazol-5-yl]piperidin-1-yl]methyl]-4-(3-methylphenyl)pyrrolidin-1-yl]-3,3-dimethylbutanoic acid |
| SMILES | Cc1cccc([C@H]2CN([C@@H](C(=O)O)C(C)(C)C)C[C@@H]2CN2CCC(c3cnc(Cc4ccc(F)cc4F)s3)CC2)c1 |
| InChI | InChI=1S/C33H41F2N3O2S/c1-21-6-5-7-23(14-21)27-20-38(31(32(39)40)33(2,3)4)19-25(27)18-37-12-10-22(11-13-37)29-17-36-30(41-29)15-24-8-9-26(34)16-28(24)35/h5-9,14,16-17,22,25,27,31H,10-13,15,18-20H2,1-4H3,(H,39,40)/t25-,27+,31-/m0/s1 |
| InChIKey | WXLYVMSQTYYONP-BVPGVAIFSA-N |
| XLogP | 6.71 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.77 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |