About [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate
[(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate (PubChem CID 59959309) has the molecular formula C9H16O4S
and a molecular weight of 220.29 g/mol. Its IUPAC name is [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate.
Molecular Properties
| Compound Name | [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate |
| PubChem CID | 59959309 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCS(=O)(=O)[C@@H]1C(C)C |
| InChI | InChI=1S/C9H16O4S/c1-6(2)9-8(13-7(3)10)4-5-14(9,11)12/h6,8-9H,4-5H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | YSXFCDDMVLGDPU-RKDXNWHRSA-N |
| XLogP | 0.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate?
The IUPAC name of [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate (CID 59959309) is [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate.
What is the SMILES notation for [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate?
The canonical SMILES for [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate is CC(=O)O[C@@H]1CCS(=O)(=O)[C@@H]1C(C)C.
What is the InChIKey of [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate?
The InChIKey is YSXFCDDMVLGDPU-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H16O4S/c1-6(2)9-8(13-7(3)10)4-5-14(9,11)12/h6,8-9H,4-5H2,1-3H3/t8-,9-/m1/s1.
What are the key properties of [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate?
[(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate has a molecular weight of 220.29 g/mol, XLogP of 0.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] acetate is sourced from PubChem (CID 59959309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).