About (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one
(2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one (PubChem CID 59959782) has the molecular formula C12H22N4O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one.
Molecular Properties
| Compound Name | (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one |
| PubChem CID | 59959782 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one |
| SMILES | CNC1CCN(C(=O)C(=N/OC)/C(C)=N/OC)CC1 |
| InChI | InChI=1S/C12H22N4O3/c1-9(14-18-3)11(15-19-4)12(17)16-7-5-10(13-2)6-8-16/h10,13H,5-8H2,1-4H3/b14-9+,15-11+ |
| InChIKey | YWRLVXUVPFNJEV-YFVJMOTDSA-N |
| XLogP | 0.22 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one?
The IUPAC name of (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one (CID 59959782) is (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one.
What is the SMILES notation for (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one?
The canonical SMILES for (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one is CNC1CCN(C(=O)C(=N/OC)/C(C)=N/OC)CC1.
What is the InChIKey of (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one?
The InChIKey is YWRLVXUVPFNJEV-YFVJMOTDSA-N. The full InChI is InChI=1S/C12H22N4O3/c1-9(14-18-3)11(15-19-4)12(17)16-7-5-10(13-2)6-8-16/h10,13H,5-8H2,1-4H3/b14-9+,15-11+.
What are the key properties of (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one?
(2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one has a molecular weight of 270.33 g/mol, XLogP of 0.22, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-2,3-bis(methoxyimino)-1-[4-(methylamino)piperidin-1-yl]butan-1-one is sourced from PubChem (CID 59959782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).