C21H20FN3O4 — CID 59959936
(3Z)-3-[(4-acetyl-1H-pyrrol-2-yl)methylidene]-4-[(3R,4S,5R)-4-amino-3,5-dihydroxyhex-1-ynyl]-5-fluoro-1H-indol-2-one (PubChem CID 59959936) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is (3Z)-3-[(4-acetyl-1H-pyrrol-2-yl)methylidene]-4-[(3R,4S,5R)-4-amino-3,5-dihydroxyhex-1-ynyl]-5-fluoro-1H-indol-2-one.
| Compound Name | (3Z)-3-[(4-acetyl-1H-pyrrol-2-yl)methylidene]-4-[(3R,4S,5R)-4-amino-3,5-dihydroxyhex-1-ynyl]-5-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 59959936 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (3Z)-3-[(4-acetyl-1H-pyrrol-2-yl)methylidene]-4-[(3R,4S,5R)-4-amino-3,5-dihydroxyhex-1-ynyl]-5-fluoro-1H-indol-2-one |
| SMILES | CC(=O)c1c[nH]c(/C=C2\C(=O)Nc3ccc(F)c(C#C[C@@H](O)[C@@H](N)[C@@H](C)O)c32)c1 |
| InChI | InChI=1S/C21H20FN3O4/c1-10(26)12-7-13(24-9-12)8-15-19-14(3-6-18(28)20(23)11(2)27)16(22)4-5-17(19)25-21(15)29/h4-5,7-9,11,18,20,24,27-28H,23H2,1-2H3,(H,25,29)/b15-8-/t11-,18-,20+/m1/s1 |
| InChIKey | AKXOYSJJFDOWAX-DIXNNETFSA-N |
| XLogP | 1.27 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|