About [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium
[2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium (PubChem CID 59960035) has the molecular formula C11H15N4O3Y-
and a molecular weight of 340.17 g/mol. Its IUPAC name is [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium.
Molecular Properties
| Compound Name | [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium |
| PubChem CID | 59960035 |
| Molecular Formula | C11H15N4O3Y- |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium |
| SMILES | CC(=O)Nc1cnc(C)n(C(C)(C)C([NH-])=O)c1=O.[Y] |
| InChI | InChI=1S/C11H16N4O3.Y/c1-6-13-5-8(14-7(2)16)9(17)15(6)11(3,4)10(12)18;/h5H,1-4H3,(H3,12,14,16,18);/p-1 |
| InChIKey | KNRKNWHGMLJFRA-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium?
The IUPAC name of [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium (CID 59960035) is [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium.
What is the SMILES notation for [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium?
The canonical SMILES for [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium is CC(=O)Nc1cnc(C)n(C(C)(C)C([NH-])=O)c1=O.[Y].
What is the InChIKey of [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium?
The InChIKey is KNRKNWHGMLJFRA-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H16N4O3.Y/c1-6-13-5-8(14-7(2)16)9(17)15(6)11(3,4)10(12)18;/h5H,1-4H3,(H3,12,14,16,18);/p-1.
What are the key properties of [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium?
[2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium has a molecular weight of 340.17 g/mol, XLogP of 0.82, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-acetamido-2-methyl-6-oxopyrimidin-1-yl)-2-methylpropanoyl]azanide;yttrium is sourced from PubChem (CID 59960035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).