C20H15N3O3 — CID 59960131
[4-[1-(4-carboxyphenyl)indazol-3-yl]phenyl]-oxidoazanium (PubChem CID 59960131) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is [4-[1-(4-carboxyphenyl)indazol-3-yl]phenyl]-oxidoazanium.
| Compound Name | [4-[1-(4-carboxyphenyl)indazol-3-yl]phenyl]-oxidoazanium |
|---|---|
| PubChem CID | 59960131 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [4-[1-(4-carboxyphenyl)indazol-3-yl]phenyl]-oxidoazanium |
| SMILES | O=C(O)c1ccc(-n2nc(-c3ccc([NH2+][O-])cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H15N3O3/c24-20(25)14-7-11-16(12-8-14)23-18-4-2-1-3-17(18)19(21-23)13-5-9-15(22-26)10-6-13/h1-12H,22H2,(H,24,25) |
| InChIKey | CNKULHUYRGGSIW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|