C17H26O4 — CID 59960404
methyl 2-[(7S)-7,8,8a-trimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate (PubChem CID 59960404) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl 2-[(7S)-7,8,8a-trimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate.
| Compound Name | methyl 2-[(7S)-7,8,8a-trimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 59960404 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl 2-[(7S)-7,8,8a-trimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate |
| SMILES | COC(=O)C(C)(O)C1CC2(C)C(=CC1=O)CC[C@H](C)C2C |
| InChI | InChI=1S/C17H26O4/c1-10-6-7-12-8-14(18)13(9-16(12,3)11(10)2)17(4,20)15(19)21-5/h8,10-11,13,20H,6-7,9H2,1-5H3/t10-,11?,13?,16?,17?/m0/s1 |
| InChIKey | FJAUQVQEFMXDJB-WPSYKOMOSA-N |
| XLogP | 2.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |