About (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol
(5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol (PubChem CID 59960409) has the molecular formula C16H24O6S
and a molecular weight of 344.43 g/mol. Its IUPAC name is (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol.
Molecular Properties
| Compound Name | (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol |
| PubChem CID | 59960409 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol |
| SMILES | COC(OC)[C@H]1OC(O)(CS(=O)(=O)c2ccccc2)C(C)C1C |
| InChI | InChI=1S/C16H24O6S/c1-11-12(2)16(17,22-14(11)15(20-3)21-4)10-23(18,19)13-8-6-5-7-9-13/h5-9,11-12,14-15,17H,10H2,1-4H3/t11?,12?,14-,16?/m0/s1 |
| InChIKey | UBEZJAANWILGGG-VWVFYJPSSA-N |
| XLogP | 1.44 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol?
The IUPAC name of (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol (CID 59960409) is (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol.
What is the SMILES notation for (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol?
The canonical SMILES for (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol is COC(OC)[C@H]1OC(O)(CS(=O)(=O)c2ccccc2)C(C)C1C.
What is the InChIKey of (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol?
The InChIKey is UBEZJAANWILGGG-VWVFYJPSSA-N. The full InChI is InChI=1S/C16H24O6S/c1-11-12(2)16(17,22-14(11)15(20-3)21-4)10-23(18,19)13-8-6-5-7-9-13/h5-9,11-12,14-15,17H,10H2,1-4H3/t11?,12?,14-,16?/m0/s1.
What are the key properties of (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol?
(5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol has a molecular weight of 344.43 g/mol, XLogP of 1.44, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol is sourced from PubChem (CID 59960409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).