C16H30O4 — CID 59960770
(1S,3R,4R,5R)-4-(3-hydroxybutyl)-5-[(Z)-7-hydroxyhept-2-enyl]cyclopentane-1,3-diol (PubChem CID 59960770) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is (1S,3R,4R,5R)-4-(3-hydroxybutyl)-5-[(Z)-7-hydroxyhept-2-enyl]cyclopentane-1,3-diol.
| Compound Name | (1S,3R,4R,5R)-4-(3-hydroxybutyl)-5-[(Z)-7-hydroxyhept-2-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 59960770 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (1S,3R,4R,5R)-4-(3-hydroxybutyl)-5-[(Z)-7-hydroxyhept-2-enyl]cyclopentane-1,3-diol |
| SMILES | CC(O)CC[C@@H]1[C@@H](C/C=C\CCCCO)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H30O4/c1-12(18)8-9-14-13(15(19)11-16(14)20)7-5-3-2-4-6-10-17/h3,5,12-20H,2,4,6-11H2,1H3/b5-3-/t12?,13-,14-,15+,16-/m1/s1 |
| InChIKey | DHRKWHSKCRJLJV-RTWTXDFESA-N |
| XLogP | 1.61 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|