About tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate
tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate (PubChem CID 59961542) has the molecular formula C20H29Cl2NO5S
and a molecular weight of 466.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate |
| PubChem CID | 59961542 |
| Molecular Formula | C20H29Cl2NO5S |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@](CCCOS(C)(=O)=O)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H29Cl2NO5S/c1-19(2,3)28-18(24)23-11-5-9-20(14-23,10-6-12-27-29(4,25)26)15-7-8-16(21)17(22)13-15/h7-8,13H,5-6,9-12,14H2,1-4H3/t20-/m1/s1 |
| InChIKey | YTYOKOBMIBGQRX-HXUWFJFHSA-N |
| XLogP | 5.02 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate (CID 59961542) is tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC[C@](CCCOS(C)(=O)=O)(c2ccc(Cl)c(Cl)c2)C1.
What is the InChIKey of tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate?
The InChIKey is YTYOKOBMIBGQRX-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H29Cl2NO5S/c1-19(2,3)28-18(24)23-11-5-9-20(14-23,10-6-12-27-29(4,25)26)15-7-8-16(21)17(22)13-15/h7-8,13H,5-6,9-12,14H2,1-4H3/t20-/m1/s1.
What are the key properties of tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate?
tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate has a molecular weight of 466.43 g/mol, XLogP of 5.02, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-3-(3,4-dichlorophenyl)-3-(3-methylsulfonyloxypropyl)piperidine-1-carboxylate is sourced from PubChem (CID 59961542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).