C13H23NO — CID 59961741
(1R,2S)-3-ethyl-1,2,8-trimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 59961741) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (1R,2S)-3-ethyl-1,2,8-trimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1R,2S)-3-ethyl-1,2,8-trimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 59961741 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (1R,2S)-3-ethyl-1,2,8-trimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CCC1[C@@H](C)[C@@H](C)C2C(C)CCC(=O)N12 |
| InChI | InChI=1S/C13H23NO/c1-5-11-9(3)10(4)13-8(2)6-7-12(15)14(11)13/h8-11,13H,5-7H2,1-4H3/t8?,9-,10+,11?,13?/m0/s1 |
| InChIKey | JEOAFIQDZNGWGQ-MBIUHZTHSA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |