C16H26O5 — CID 59961755
1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-en-1-ol (PubChem CID 59961755) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-en-1-ol.
| Compound Name | 1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 59961755 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-en-1-ol |
| SMILES | C=CC(O)C1OC2(CCCCC2)OC1C1COC(C)(C)O1 |
| InChI | InChI=1S/C16H26O5/c1-4-11(17)13-14(12-10-18-15(2,3)19-12)21-16(20-13)8-6-5-7-9-16/h4,11-14,17H,1,5-10H2,2-3H3 |
| InChIKey | APAOAVMFZLQYHU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|