About methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid
methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid (PubChem CID 59962428) has the molecular formula C10H12BNO2
and a molecular weight of 189.02 g/mol. Its IUPAC name is methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid.
Molecular Properties
| Compound Name | methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid |
| PubChem CID | 59962428 |
| Molecular Formula | C10H12BNO2 |
| Molecular Weight | 189.02 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid |
| SMILES | CB(O)N1CC2CC23C(=O)C=CC=C13 |
| InChI | InChI=1S/C10H12BNO2/c1-11(14)12-6-7-5-10(7)8(12)3-2-4-9(10)13/h2-4,7,14H,5-6H2,1H3 |
| InChIKey | ORKLVXNLRMSHND-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.02 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid?
The IUPAC name of methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid (CID 59962428) is methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid.
What is the SMILES notation for methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid?
The canonical SMILES for methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid is CB(O)N1CC2CC23C(=O)C=CC=C13.
What is the InChIKey of methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid?
The InChIKey is ORKLVXNLRMSHND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BNO2/c1-11(14)12-6-7-5-10(7)8(12)3-2-4-9(10)13/h2-4,7,14H,5-6H2,1H3.
What are the key properties of methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid?
methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid has a molecular weight of 189.02 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(7-oxo-1a,2-dihydro-1H-cyclopropa[c]indol-3-yl)borinic acid is sourced from PubChem (CID 59962428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).