C13H11NO — CID 59962431
14-oxa-10-azatetracyclo[7.5.1.02,7.012,15]pentadeca-1(15),2,4,6,8-pentaene (PubChem CID 59962431) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is 14-oxa-10-azatetracyclo[7.5.1.02,7.012,15]pentadeca-1(15),2,4,6,8-pentaene.
| Compound Name | 14-oxa-10-azatetracyclo[7.5.1.02,7.012,15]pentadeca-1(15),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 59962431 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 14-oxa-10-azatetracyclo[7.5.1.02,7.012,15]pentadeca-1(15),2,4,6,8-pentaene |
| SMILES | c1ccc2c3c4c(cc2c1)NCC4CO3 |
| InChI | InChI=1S/C13H11NO/c1-2-4-10-8(3-1)5-11-12-9(6-14-11)7-15-13(10)12/h1-5,9,14H,6-7H2 |
| InChIKey | YGWOYKHHGNWVBC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |