C15H22O3S — CID 59962498
(5R)-2,2,3,3,5-pentamethyl-1,1-dioxo-4,5-dihydro-1λ6-benzothiepin-4-ol (PubChem CID 59962498) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is (5R)-2,2,3,3,5-pentamethyl-1,1-dioxo-4,5-dihydro-1λ6-benzothiepin-4-ol.
| Compound Name | (5R)-2,2,3,3,5-pentamethyl-1,1-dioxo-4,5-dihydro-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 59962498 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (5R)-2,2,3,3,5-pentamethyl-1,1-dioxo-4,5-dihydro-1λ6-benzothiepin-4-ol |
| SMILES | C[C@@H]1c2ccccc2S(=O)(=O)C(C)(C)C(C)(C)C1O |
| InChI | InChI=1S/C15H22O3S/c1-10-11-8-6-7-9-12(11)19(17,18)15(4,5)14(2,3)13(10)16/h6-10,13,16H,1-5H3/t10-,13?/m1/s1 |
| InChIKey | YESVFALOKNATER-VUUHIHSGSA-N |
| XLogP | 2.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |