C13H21N2+ — CID 59962901
[4,5-dimethyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]-methylazanium (PubChem CID 59962901) has the molecular formula C13H21N2+ and a molecular weight of 205.32 g/mol. Its IUPAC name is [4,5-dimethyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]-methylazanium.
| Compound Name | [4,5-dimethyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]-methylazanium |
|---|---|
| PubChem CID | 59962901 |
| Molecular Formula | C13H21N2+ |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | [4,5-dimethyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]-methylazanium |
| SMILES | CNC=CC=CC(C)=C(C)C=C/C=[NH+]/C |
| InChI | InChI=1S/C13H20N2/c1-12(8-5-6-10-14-3)13(2)9-7-11-15-4/h5-11,14H,1-4H3/p+1/b8-5?,9-7?,10-6?,13-12?,15-11+ |
| InChIKey | AOWZQCBHVUIFGG-XZNGGMCTSA-O |
| XLogP | 0.95 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|