C14H23N2+ — CID 59962921
methyl-[2,5,8-trimethyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium (PubChem CID 59962921) has the molecular formula C14H23N2+ and a molecular weight of 219.35 g/mol. Its IUPAC name is methyl-[2,5,8-trimethyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium.
| Compound Name | methyl-[2,5,8-trimethyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium |
|---|---|
| PubChem CID | 59962921 |
| Molecular Formula | C14H23N2+ |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | methyl-[2,5,8-trimethyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium |
| SMILES | CNC=C(C)C=CC(C)=CC=C(C)/C=[NH+]/C |
| InChI | InChI=1S/C14H22N2/c1-12(6-8-13(2)10-15-4)7-9-14(3)11-16-5/h6-11,15H,1-5H3/p+1/b8-6?,12-7?,13-10?,14-9?,16-11+ |
| InChIKey | XGBQNOVQAFCQBY-XZZHOPSVSA-O |
| XLogP | 1.34 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|