About CID 59963392
CID 59963392 (PubChem CID 59963392) has the molecular formula C23H44FO2Si
and a molecular weight of 399.69 g/mol.
Molecular Properties
| Compound Name | CID 59963392 |
| PubChem CID | 59963392 |
| Molecular Formula | C23H44FO2Si |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | — |
| SMILES | CCCC/C=C\CC1C(O)CC(C)[C@@H]1CCC(O[Si](C)C)C(F)CCCC |
| InChI | InChI=1S/C23H44FO2Si/c1-6-8-10-11-12-13-20-19(18(3)17-22(20)25)15-16-23(26-27(4)5)21(24)14-9-7-2/h11-12,18-23,25H,6-10,13-17H2,1-5H3/b12-11-/t18?,19-,20?,21?,22?,23?/m0/s1 |
| InChIKey | UOARZNIOYWGWJY-KGTFJTLHSA-N |
| XLogP | 6.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 59963392 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59963392?
The IUPAC name of CID 59963392 (CID 59963392) is not available.
What is the SMILES notation for CID 59963392?
The canonical SMILES for CID 59963392 is CCCC/C=C\CC1C(O)CC(C)[C@@H]1CCC(O[Si](C)C)C(F)CCCC.
What is the InChIKey of CID 59963392?
The InChIKey is UOARZNIOYWGWJY-KGTFJTLHSA-N. The full InChI is InChI=1S/C23H44FO2Si/c1-6-8-10-11-12-13-20-19(18(3)17-22(20)25)15-16-23(26-27(4)5)21(24)14-9-7-2/h11-12,18-23,25H,6-10,13-17H2,1-5H3/b12-11-/t18?,19-,20?,21?,22?,23?/m0/s1.
What are the key properties of CID 59963392?
CID 59963392 has a molecular weight of 399.69 g/mol, XLogP of 6.70, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59963392 is sourced from PubChem (CID 59963392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).