C19H32O4 — CID 59963463
(4S)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 59963463) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (4S)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (4S)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 59963463 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (4S)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCCCCC1(CC[C@H]2C=CC3OC(O)CC32)OCCO1 |
| InChI | InChI=1S/C19H32O4/c1-2-3-4-5-6-10-19(21-12-13-22-19)11-9-15-7-8-17-16(15)14-18(20)23-17/h7-8,15-18,20H,2-6,9-14H2,1H3/t15-,16?,17?,18?/m1/s1 |
| InChIKey | JIMACPRDQFVDFH-VGZZGSPPSA-N |
| XLogP | 3.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|