C12H21N3O4S2 — CID 59963557
trans-methyl (4R,11R)-11-amino-7,7-dimethyl-6,10-dioxo-1,2-dithia-5,9-diazacyclododecane-4-carboxylate (PubChem CID 59963557) has the molecular formula C12H21N3O4S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is trans-methyl (4R,11R)-11-amino-7,7-dimethyl-6,10-dioxo-1,2-dithia-5,9-diazacyclododecane-4-carboxylate.
| Compound Name | trans-methyl (4R,11R)-11-amino-7,7-dimethyl-6,10-dioxo-1,2-dithia-5,9-diazacyclododecane-4-carboxylate |
|---|---|
| PubChem CID | 59963557 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | trans-methyl (4R,11R)-11-amino-7,7-dimethyl-6,10-dioxo-1,2-dithia-5,9-diazacyclododecane-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CSSC[C@H](N)C(=O)NCC(C)(C)C(=O)N1 |
| InChI | InChI=1S/C12H21N3O4S2/c1-12(2)6-14-9(16)7(13)4-20-21-5-8(10(17)19-3)15-11(12)18/h7-8H,4-6,13H2,1-3H3,(H,14,16)(H,15,18)/t7-,8-/m0/s1 |
| InChIKey | QWCYCURAIBODNS-YUMQZZPRSA-N |
| XLogP | -0.49 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|