C13H23NOSi — CID 59964079
N-[(3-methoxy-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilyl]methanamine (PubChem CID 59964079) has the molecular formula C13H23NOSi and a molecular weight of 237.42 g/mol. Its IUPAC name is N-[(3-methoxy-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilyl]methanamine.
| Compound Name | N-[(3-methoxy-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilyl]methanamine |
|---|---|
| PubChem CID | 59964079 |
| Molecular Formula | C13H23NOSi |
| Molecular Weight | 237.42 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-[(3-methoxy-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilyl]methanamine |
| SMILES | CN[Si](C)(C)C1CC(OC)C2C=CC=CC21 |
| InChI | InChI=1S/C13H23NOSi/c1-14-16(3,4)13-9-12(15-2)10-7-5-6-8-11(10)13/h5-8,10-14H,9H2,1-4H3 |
| InChIKey | NIWULMKLUCNWGR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|