About N-propylidenepropanamide
N-propylidenepropanamide (PubChem CID 59964212) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is N-propylidenepropanamide.
Molecular Properties
| Compound Name | N-propylidenepropanamide |
| PubChem CID | 59964212 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | N-propylidenepropanamide |
| SMILES | CC/C=N/C(=O)CC |
| InChI | InChI=1S/C6H11NO/c1-3-5-7-6(8)4-2/h5H,3-4H2,1-2H3/b7-5+ |
| InChIKey | MKWQUZVPQVURLH-FNORWQNLSA-N |
| XLogP | 1.40 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-propylidenepropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylidenepropanamide?
The IUPAC name of N-propylidenepropanamide (CID 59964212) is N-propylidenepropanamide.
What is the SMILES notation for N-propylidenepropanamide?
The canonical SMILES for N-propylidenepropanamide is CC/C=N/C(=O)CC.
What is the InChIKey of N-propylidenepropanamide?
The InChIKey is MKWQUZVPQVURLH-FNORWQNLSA-N. The full InChI is InChI=1S/C6H11NO/c1-3-5-7-6(8)4-2/h5H,3-4H2,1-2H3/b7-5+.
What are the key properties of N-propylidenepropanamide?
N-propylidenepropanamide has a molecular weight of 113.16 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylidenepropanamide is sourced from PubChem (CID 59964212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).