About carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium)
carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium) (PubChem CID 59964345) has the molecular formula C12H20N2Y2-4
and a molecular weight of 370.12 g/mol. Its IUPAC name is carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium).
Molecular Properties
| Compound Name | carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium) |
| PubChem CID | 59964345 |
| Molecular Formula | C12H20N2Y2-4 |
| Molecular Weight | 370.12 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium) |
| SMILES | C[CH-]c1nc(C)c([CH-]C)nc1C.[CH3-].[CH3-].[Y].[Y] |
| InChI | InChI=1S/C10H14N2.2CH3.2Y/c1-5-9-7(3)12-10(6-2)8(4)11-9;;;;/h5-6H,1-4H3;2*1H3;;/q-2;2*-1;; |
| InChIKey | BPCNNDYFCWLQTI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.12 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium)?
The IUPAC name of carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium) (CID 59964345) is carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium).
What is the SMILES notation for carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium)?
The canonical SMILES for carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium) is C[CH-]c1nc(C)c([CH-]C)nc1C.[CH3-].[CH3-].[Y].[Y].
What is the InChIKey of carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium)?
The InChIKey is BPCNNDYFCWLQTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.2CH3.2Y/c1-5-9-7(3)12-10(6-2)8(4)11-9;;;;/h5-6H,1-4H3;2*1H3;;/q-2;2*-1;;.
What are the key properties of carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium)?
carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium) has a molecular weight of 370.12 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2,5-di(ethyl)-3,6-dimethylpyrazine;bis(yttrium) is sourced from PubChem (CID 59964345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).