About 2,4-diethyl-3,5,6-trimethylpyridine
2,4-diethyl-3,5,6-trimethylpyridine (PubChem CID 59964349) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 2,4-diethyl-3,5,6-trimethylpyridine.
Molecular Properties
| Compound Name | 2,4-diethyl-3,5,6-trimethylpyridine |
| PubChem CID | 59964349 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2,4-diethyl-3,5,6-trimethylpyridine |
| SMILES | CCc1nc(C)c(C)c(CC)c1C |
| InChI | InChI=1S/C12H19N/c1-6-11-8(3)10(5)13-12(7-2)9(11)4/h6-7H2,1-5H3 |
| InChIKey | XDAZSHXGYUGZOR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-diethyl-3,5,6-trimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethyl-3,5,6-trimethylpyridine?
The IUPAC name of 2,4-diethyl-3,5,6-trimethylpyridine (CID 59964349) is 2,4-diethyl-3,5,6-trimethylpyridine.
What is the SMILES notation for 2,4-diethyl-3,5,6-trimethylpyridine?
The canonical SMILES for 2,4-diethyl-3,5,6-trimethylpyridine is CCc1nc(C)c(C)c(CC)c1C.
What is the InChIKey of 2,4-diethyl-3,5,6-trimethylpyridine?
The InChIKey is XDAZSHXGYUGZOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-6-11-8(3)10(5)13-12(7-2)9(11)4/h6-7H2,1-5H3.
What are the key properties of 2,4-diethyl-3,5,6-trimethylpyridine?
2,4-diethyl-3,5,6-trimethylpyridine has a molecular weight of 177.29 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethyl-3,5,6-trimethylpyridine is sourced from PubChem (CID 59964349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).