About CID 59964396
CID 59964396 (PubChem CID 59964396) has the molecular formula C20H33O2Si
and a molecular weight of 333.57 g/mol.
Molecular Properties
| Compound Name | CID 59964396 |
| PubChem CID | 59964396 |
| Molecular Formula | C20H33O2Si |
| Molecular Weight | 333.57 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | — |
| SMILES | C[C@H](C/C=C/C(C)(C)O[Si](C)C)C1=CCC2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C20H33O2Si/c1-15(9-7-13-19(2,3)22-23(5)6)16-11-12-17-18(21)10-8-14-20(16,17)4/h7,11,13,15,17H,8-10,12,14H2,1-6H3/b13-7+/t15-,17?,20-/m1/s1 |
| InChIKey | YCCYPEXWAFYHGU-RJAWNXFRSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 59964396 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59964396?
The IUPAC name of CID 59964396 (CID 59964396) is not available.
What is the SMILES notation for CID 59964396?
The canonical SMILES for CID 59964396 is C[C@H](C/C=C/C(C)(C)O[Si](C)C)C1=CCC2C(=O)CCC[C@]12C.
What is the InChIKey of CID 59964396?
The InChIKey is YCCYPEXWAFYHGU-RJAWNXFRSA-N. The full InChI is InChI=1S/C20H33O2Si/c1-15(9-7-13-19(2,3)22-23(5)6)16-11-12-17-18(21)10-8-14-20(16,17)4/h7,11,13,15,17H,8-10,12,14H2,1-6H3/b13-7+/t15-,17?,20-/m1/s1.
What are the key properties of CID 59964396?
CID 59964396 has a molecular weight of 333.57 g/mol, XLogP of 5.32, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59964396 is sourced from PubChem (CID 59964396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).