C11H17Cl — CID 59964397
cis-(1Z,3S,5R)-1-(2-chloroethylidene)-3,5-dimethyl-2-methylidenecyclohexane (PubChem CID 59964397) has the molecular formula C11H17Cl and a molecular weight of 184.71 g/mol. Its IUPAC name is cis-(1Z,3S,5R)-1-(2-chloroethylidene)-3,5-dimethyl-2-methylidenecyclohexane.
| Compound Name | cis-(1Z,3S,5R)-1-(2-chloroethylidene)-3,5-dimethyl-2-methylidenecyclohexane |
|---|---|
| PubChem CID | 59964397 |
| Molecular Formula | C11H17Cl |
| Molecular Weight | 184.71 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | cis-(1Z,3S,5R)-1-(2-chloroethylidene)-3,5-dimethyl-2-methylidenecyclohexane |
| SMILES | C=C1/C(=C\CCl)C[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C11H17Cl/c1-8-6-9(2)10(3)11(7-8)4-5-12/h4,8-9H,3,5-7H2,1-2H3/b11-4-/t8-,9+/m1/s1 |
| InChIKey | KQXZVQGTRSRCFK-AXANJZOCSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|