About 5,6-dimethyl-1,3-dihydro-2-benzofuran
5,6-dimethyl-1,3-dihydro-2-benzofuran (PubChem CID 59964418) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 5,6-dimethyl-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 5,6-dimethyl-1,3-dihydro-2-benzofuran |
| PubChem CID | 59964418 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 5,6-dimethyl-1,3-dihydro-2-benzofuran |
| SMILES | Cc1cc2c(cc1C)COC2 |
| InChI | InChI=1S/C10H12O/c1-7-3-9-5-11-6-10(9)4-8(7)2/h3-4H,5-6H2,1-2H3 |
| InChIKey | GZSNLUJFJCHPAJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-dimethyl-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-1,3-dihydro-2-benzofuran?
The IUPAC name of 5,6-dimethyl-1,3-dihydro-2-benzofuran (CID 59964418) is 5,6-dimethyl-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 5,6-dimethyl-1,3-dihydro-2-benzofuran?
The canonical SMILES for 5,6-dimethyl-1,3-dihydro-2-benzofuran is Cc1cc2c(cc1C)COC2.
What is the InChIKey of 5,6-dimethyl-1,3-dihydro-2-benzofuran?
The InChIKey is GZSNLUJFJCHPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-7-3-9-5-11-6-10(9)4-8(7)2/h3-4H,5-6H2,1-2H3.
What are the key properties of 5,6-dimethyl-1,3-dihydro-2-benzofuran?
5,6-dimethyl-1,3-dihydro-2-benzofuran has a molecular weight of 148.20 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 59964418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).