C32H59NO9 — CID 59965172
(14R)-6-[(6R)-4-(dimethylamino)-3-methoxy-6-methyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-4-methoxy-3,5,7,7,9,11,13-heptamethyl-oxacyclotetradecane-2,10-dione (PubChem CID 59965172) has the molecular formula C32H59NO9 and a molecular weight of 601.82 g/mol. Its IUPAC name is (14R)-6-[(6R)-4-(dimethylamino)-3-methoxy-6-methyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-4-methoxy-3,5,7,7,9,11,13-heptamethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (14R)-6-[(6R)-4-(dimethylamino)-3-methoxy-6-methyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-4-methoxy-3,5,7,7,9,11,13-heptamethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 59965172 |
| Molecular Formula | C32H59NO9 |
| Molecular Weight | 601.82 g/mol |
| Exact Mass | 601.42 |
| IUPAC Name | (14R)-6-[(6R)-4-(dimethylamino)-3-methoxy-6-methyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-4-methoxy-3,5,7,7,9,11,13-heptamethyl-oxacyclotetradecane-2,10-dione |
| SMILES | CC[C@H]1OC(=O)C(C)C(OC)C(C)C(OC2O[C@H](C)CC(N(C)C)C2OC)C(C)(C)CC(C)C(=O)C(C)C(O)C1(C)O |
| InChI | InChI=1S/C32H59NO9/c1-14-23-32(9,37)27(35)19(4)24(34)17(2)16-31(7,8)28(20(5)25(38-12)21(6)29(36)41-23)42-30-26(39-13)22(33(10)11)15-18(3)40-30/h17-23,25-28,30,35,37H,14-16H2,1-13H3/t17?,18-,19?,20?,21?,22?,23-,25?,26?,27?,28?,30?,32?/m1/s1 |
| InChIKey | UYJHWBWZFDQXRA-UWTDPONFSA-N |
| XLogP | 3.44 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |