C20H6Br4Na2O4 — CID 59965239
disodium;2-(2,4,5,7-tetrabromo-6-oxo-3H-xanthen-3-id-9-yl)benzoate (PubChem CID 59965239) has the molecular formula C20H6Br4Na2O4 and a molecular weight of 675.86 g/mol. Its IUPAC name is disodium;2-(2,4,5,7-tetrabromo-6-oxo-3H-xanthen-3-id-9-yl)benzoate.
| Compound Name | disodium;2-(2,4,5,7-tetrabromo-6-oxo-3H-xanthen-3-id-9-yl)benzoate |
|---|---|
| PubChem CID | 59965239 |
| Molecular Formula | C20H6Br4Na2O4 |
| Molecular Weight | 675.86 g/mol |
| Exact Mass | 671.68 |
| IUPAC Name | disodium;2-(2,4,5,7-tetrabromo-6-oxo-3H-xanthen-3-id-9-yl)benzoate |
| SMILES | O=C([O-])c1ccccc1-c1c2cc(Br)c(=O)c(Br)c-2oc2c(Br)[c-]c(Br)cc12.[Na+].[Na+] |
| InChI | InChI=1S/C20H7Br4O4.2Na/c21-8-5-11-15(9-3-1-2-4-10(9)20(26)27)12-7-13(22)17(25)16(24)19(12)28-18(11)14(23)6-8;;/h1-5,7H,(H,26,27);;/q-1;2*+1/p-1 |
| InChIKey | VXPCHNFABLGDFH-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 70.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.86 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|