About CID 59965295
CID 59965295 (PubChem CID 59965295) has the molecular formula C35H44AlN2O3
and a molecular weight of 567.73 g/mol.
Molecular Properties
| Compound Name | CID 59965295 |
| PubChem CID | 59965295 |
| Molecular Formula | C35H44AlN2O3 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | — |
| SMILES | CCCCCC(=O)c1ccnc2c(O[Al]Oc3c(C(C)CCC(CC)CCCC)ccc4cccnc34)cccc12 |
| InChI | InChI=1S/C20H29NO.C15H17NO2.Al/c1-4-6-8-16(5-2)11-10-15(3)18-13-12-17-9-7-14-21-19(17)20(18)22;1-2-3-4-7-13(17)11-9-10-16-15-12(11)6-5-8-14(15)18;/h7,9,12-16,22H,4-6,8,10-11H2,1-3H3;5-6,8-10,18H,2-4,7H2,1H3;/q;;+2/p-2 |
| InChIKey | RLOOTELEHSYBHC-UHFFFAOYSA-L |
| XLogP | 9.64 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 59965295 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59965295?
The IUPAC name of CID 59965295 (CID 59965295) is not available.
What is the SMILES notation for CID 59965295?
The canonical SMILES for CID 59965295 is CCCCCC(=O)c1ccnc2c(O[Al]Oc3c(C(C)CCC(CC)CCCC)ccc4cccnc34)cccc12.
What is the InChIKey of CID 59965295?
The InChIKey is RLOOTELEHSYBHC-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H29NO.C15H17NO2.Al/c1-4-6-8-16(5-2)11-10-15(3)18-13-12-17-9-7-14-21-19(17)20(18)22;1-2-3-4-7-13(17)11-9-10-16-15-12(11)6-5-8-14(15)18;/h7,9,12-16,22H,4-6,8,10-11H2,1-3H3;5-6,8-10,18H,2-4,7H2,1H3;/q;;+2/p-2.
What are the key properties of CID 59965295?
CID 59965295 has a molecular weight of 567.73 g/mol, XLogP of 9.64, 17 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59965295 is sourced from PubChem (CID 59965295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).