About (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine
(5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine (PubChem CID 59965323) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine.
Molecular Properties
| Compound Name | (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine |
| PubChem CID | 59965323 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine |
| SMILES | C=C1O/C(=C\C)C(=C)N1C |
| InChI | InChI=1S/C8H11NO/c1-5-8-6(2)9(4)7(3)10-8/h5H,2-3H2,1,4H3/b8-5- |
| InChIKey | NPMATSRJKKRGII-YVMONPNESA-N |
| XLogP | 1.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine?
The IUPAC name of (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine (CID 59965323) is (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine.
What is the SMILES notation for (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine?
The canonical SMILES for (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine is C=C1O/C(=C\C)C(=C)N1C.
What is the InChIKey of (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine?
The InChIKey is NPMATSRJKKRGII-YVMONPNESA-N. The full InChI is InChI=1S/C8H11NO/c1-5-8-6(2)9(4)7(3)10-8/h5H,2-3H2,1,4H3/b8-5-.
What are the key properties of (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine?
(5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine has a molecular weight of 137.18 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-ethylidene-3-methyl-2,4-dimethylidene-1,3-oxazolidine is sourced from PubChem (CID 59965323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).