C20H30O2 — CID 59966621
(10R,13R,17S)-10,13,17-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol (PubChem CID 59966621) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (10R,13R,17S)-10,13,17-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (10R,13R,17S)-10,13,17-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 59966621 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (10R,13R,17S)-10,13,17-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
| SMILES | C[C@H]1CCC2C3=CC=C4CC(O)CC(O)[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C20H30O2/c1-12-4-7-16-15-6-5-13-10-14(21)11-18(22)20(13,3)17(15)8-9-19(12,16)2/h5-6,12,14,16-18,21-22H,4,7-11H2,1-3H3/t12-,14?,16?,17?,18?,19+,20-/m0/s1 |
| InChIKey | XFULJLNGQYJMKF-LZHUUZHZSA-N |
| XLogP | 3.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |