About CID 59967109
CID 59967109 (PubChem CID 59967109) has the molecular formula C29H60N2Si2
and a molecular weight of 492.99 g/mol.
Molecular Properties
| Compound Name | CID 59967109 |
| PubChem CID | 59967109 |
| Molecular Formula | C29H60N2Si2 |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.43 |
| IUPAC Name | — |
| SMILES | C[C]1C(C)C(C)C(C)C1[Si](C)(C[Si](C)(NC(C)(C)C)C1[C](C)C(C)C(C)C1C)NC(C)(C)C |
| InChI | InChI=1S/C29H60N2Si2/c1-18-19(2)23(6)26(22(18)5)32(15,30-28(9,10)11)17-33(16,31-29(12,13)14)27-24(7)20(3)21(4)25(27)8/h18-22,24,26-27,30-31H,17H2,1-16H3 |
| InChIKey | FYILFHXCOUWJJA-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59967109 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59967109?
The IUPAC name of CID 59967109 (CID 59967109) is not available.
What is the SMILES notation for CID 59967109?
The canonical SMILES for CID 59967109 is C[C]1C(C)C(C)C(C)C1[Si](C)(C[Si](C)(NC(C)(C)C)C1[C](C)C(C)C(C)C1C)NC(C)(C)C.
What is the InChIKey of CID 59967109?
The InChIKey is FYILFHXCOUWJJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H60N2Si2/c1-18-19(2)23(6)26(22(18)5)32(15,30-28(9,10)11)17-33(16,31-29(12,13)14)27-24(7)20(3)21(4)25(27)8/h18-22,24,26-27,30-31H,17H2,1-16H3.
What are the key properties of CID 59967109?
CID 59967109 has a molecular weight of 492.99 g/mol, XLogP of 8.23, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59967109 is sourced from PubChem (CID 59967109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).