C27H35NO4 — CID 59967188
[4-[(6R,7R)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] hexanoate (PubChem CID 59967188) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is [4-[(6R,7R)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] hexanoate.
| Compound Name | [4-[(6R,7R)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] hexanoate |
|---|---|
| PubChem CID | 59967188 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | [4-[(6R,7R)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccc([C@@H]2C3COC(C)(C)N3C(=O)[C@@H]2C(C)C)c2ccccc12 |
| InChI | InChI=1S/C27H35NO4/c1-6-7-8-13-23(29)32-22-15-14-20(18-11-9-10-12-19(18)22)25-21-16-31-27(4,5)28(21)26(30)24(25)17(2)3/h9-12,14-15,17,21,24-25H,6-8,13,16H2,1-5H3/t21?,24-,25-/m1/s1 |
| InChIKey | WKJVDBKUDKRYGB-LYWQJQBASA-N |
| XLogP | 5.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|