About CID 59967308
CID 59967308 (PubChem CID 59967308) has the molecular formula C10H18N2O2-
and a molecular weight of 198.27 g/mol.
Molecular Properties
| Compound Name | CID 59967308 |
| PubChem CID | 59967308 |
| Molecular Formula | C10H18N2O2- |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | — |
| SMILES | CC1C2C(N1[O-])C(C)(C)N([O])C2(C)C |
| InChI | InChI=1S/C10H18N2O2/c1-6-7-8(11(6)13)10(4,5)12(14)9(7,2)3/h6-8H,1-5H3/q-1 |
| InChIKey | BBYZYYLONKQVOG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 59967308 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59967308?
The IUPAC name of CID 59967308 (CID 59967308) is not available.
What is the SMILES notation for CID 59967308?
The canonical SMILES for CID 59967308 is CC1C2C(N1[O-])C(C)(C)N([O])C2(C)C.
What is the InChIKey of CID 59967308?
The InChIKey is BBYZYYLONKQVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-6-7-8(11(6)13)10(4,5)12(14)9(7,2)3/h6-8H,1-5H3/q-1.
What are the key properties of CID 59967308?
CID 59967308 has a molecular weight of 198.27 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59967308 is sourced from PubChem (CID 59967308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).