About pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate
pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate (PubChem CID 59967406) has the molecular formula C17H34N2O2
and a molecular weight of 298.47 g/mol. Its IUPAC name is pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate.
Molecular Properties
| Compound Name | pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate |
| PubChem CID | 59967406 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate |
| SMILES | CCC(CC)OC(=O)[C@H](C(C)CC)N1CC(C)C[C@@H](N)C1 |
| InChI | InChI=1S/C17H34N2O2/c1-6-13(5)16(17(20)21-15(7-2)8-3)19-10-12(4)9-14(18)11-19/h12-16H,6-11,18H2,1-5H3/t12?,13?,14-,16+/m1/s1 |
| InChIKey | DKWXRUZRGMVEJS-MNSOJDNVSA-N |
| XLogP | 2.80 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate?
The IUPAC name of pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate (CID 59967406) is pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate.
What is the SMILES notation for pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate?
The canonical SMILES for pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate is CCC(CC)OC(=O)[C@H](C(C)CC)N1CC(C)C[C@@H](N)C1.
What is the InChIKey of pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate?
The InChIKey is DKWXRUZRGMVEJS-MNSOJDNVSA-N. The full InChI is InChI=1S/C17H34N2O2/c1-6-13(5)16(17(20)21-15(7-2)8-3)19-10-12(4)9-14(18)11-19/h12-16H,6-11,18H2,1-5H3/t12?,13?,14-,16+/m1/s1.
What are the key properties of pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate?
pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate has a molecular weight of 298.47 g/mol, XLogP of 2.80, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-yl (2S)-2-[(3R)-3-amino-5-methylpiperidin-1-yl]-3-methylpentanoate is sourced from PubChem (CID 59967406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).