C16H31NO2 — CID 59967442
N-[4,6,6-trimethyl-2-[(2R,3R)-3-methylpentan-2-yl]oxan-3-yl]acetamide (PubChem CID 59967442) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is N-[4,6,6-trimethyl-2-[(2R,3R)-3-methylpentan-2-yl]oxan-3-yl]acetamide.
| Compound Name | N-[4,6,6-trimethyl-2-[(2R,3R)-3-methylpentan-2-yl]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 59967442 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | N-[4,6,6-trimethyl-2-[(2R,3R)-3-methylpentan-2-yl]oxan-3-yl]acetamide |
| SMILES | CC[C@@H](C)[C@@H](C)C1OC(C)(C)CC(C)C1NC(C)=O |
| InChI | InChI=1S/C16H31NO2/c1-8-10(2)12(4)15-14(17-13(5)18)11(3)9-16(6,7)19-15/h10-12,14-15H,8-9H2,1-7H3,(H,17,18)/t10-,11?,12-,14?,15?/m1/s1 |
| InChIKey | DRMATMSHKQHKIF-MASVLEMTSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |