About azanide;dimethylaminomethanone;yttrium
azanide;dimethylaminomethanone;yttrium (PubChem CID 59967458) has the molecular formula C3H8N2OY-2
and a molecular weight of 177.02 g/mol. Its IUPAC name is azanide;dimethylaminomethanone;yttrium.
Molecular Properties
| Compound Name | azanide;dimethylaminomethanone;yttrium |
| PubChem CID | 59967458 |
| Molecular Formula | C3H8N2OY-2 |
| Molecular Weight | 177.02 g/mol |
| Exact Mass | 176.97 |
| IUPAC Name | azanide;dimethylaminomethanone;yttrium |
| SMILES | CN(C)[C-]=O.[NH2-].[Y] |
| InChI | InChI=1S/C3H6NO.H2N.Y/c1-4(2)3-5;;/h1-2H3;1H2;/q2*-1; |
| InChIKey | YZOLQTQGMVSIMX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 53.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.02 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze azanide;dimethylaminomethanone;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;dimethylaminomethanone;yttrium?
The IUPAC name of azanide;dimethylaminomethanone;yttrium (CID 59967458) is azanide;dimethylaminomethanone;yttrium.
What is the SMILES notation for azanide;dimethylaminomethanone;yttrium?
The canonical SMILES for azanide;dimethylaminomethanone;yttrium is CN(C)[C-]=O.[NH2-].[Y].
What is the InChIKey of azanide;dimethylaminomethanone;yttrium?
The InChIKey is YZOLQTQGMVSIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6NO.H2N.Y/c1-4(2)3-5;;/h1-2H3;1H2;/q2*-1;.
What are the key properties of azanide;dimethylaminomethanone;yttrium?
azanide;dimethylaminomethanone;yttrium has a molecular weight of 177.02 g/mol, XLogP of 0.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;dimethylaminomethanone;yttrium is sourced from PubChem (CID 59967458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).