C17H29N2O9P — CID 59968139
[(2R)-4-[(2R)-2-acetamido-3-[2-isocyanatoethoxy(prop-2-enoxy)phosphoryl]oxypropoxy]butan-2-yl] acetate (PubChem CID 59968139) has the molecular formula C17H29N2O9P and a molecular weight of 436.40 g/mol. Its IUPAC name is [(2R)-4-[(2R)-2-acetamido-3-[2-isocyanatoethoxy(prop-2-enoxy)phosphoryl]oxypropoxy]butan-2-yl] acetate.
| Compound Name | [(2R)-4-[(2R)-2-acetamido-3-[2-isocyanatoethoxy(prop-2-enoxy)phosphoryl]oxypropoxy]butan-2-yl] acetate |
|---|---|
| PubChem CID | 59968139 |
| Molecular Formula | C17H29N2O9P |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [(2R)-4-[(2R)-2-acetamido-3-[2-isocyanatoethoxy(prop-2-enoxy)phosphoryl]oxypropoxy]butan-2-yl] acetate |
| SMILES | C=CCOP(=O)(OCCN=C=O)OC[C@@H](COCC[C@@H](C)OC(C)=O)NC(C)=O |
| InChI | InChI=1S/C17H29N2O9P/c1-5-8-25-29(23,26-10-7-18-13-20)27-12-17(19-15(3)21)11-24-9-6-14(2)28-16(4)22/h5,14,17H,1,6-12H2,2-4H3,(H,19,21)/t14-,17-,29?/m1/s1 |
| InChIKey | DNGWCNQQMYNZRA-WBDWOHCGSA-N |
| XLogP | 1.53 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|