About CID 59968219
CID 59968219 (PubChem CID 59968219) has the molecular formula C30H62Si4
and a molecular weight of 535.17 g/mol.
Molecular Properties
| Compound Name | CID 59968219 |
| PubChem CID | 59968219 |
| Molecular Formula | C30H62Si4 |
| Molecular Weight | 535.17 g/mol |
| Exact Mass | 534.39 |
| IUPAC Name | — |
| SMILES | C=C(C)C=CCCC[Si]C[Si](C)(C)C[Si]C[Si](C)(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C30H62Si4/c1-8-10-12-14-16-21-25-34(7,26-22-17-15-13-11-9-2)29-32-28-33(5,6)27-31-24-20-18-19-23-30(3)4/h19,23H,3,8-18,20-22,24-29H2,1-2,4-7H3 |
| InChIKey | PZYVPESNOIQJLJ-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.17 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 59968219 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59968219?
The IUPAC name of CID 59968219 (CID 59968219) is not available.
What is the SMILES notation for CID 59968219?
The canonical SMILES for CID 59968219 is C=C(C)C=CCCC[Si]C[Si](C)(C)C[Si]C[Si](C)(CCCCCCCC)CCCCCCCC.
What is the InChIKey of CID 59968219?
The InChIKey is PZYVPESNOIQJLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H62Si4/c1-8-10-12-14-16-21-25-34(7,26-22-17-15-13-11-9-2)29-32-28-33(5,6)27-31-24-20-18-19-23-30(3)4/h19,23H,3,8-18,20-22,24-29H2,1-2,4-7H3.
What are the key properties of CID 59968219?
CID 59968219 has a molecular weight of 535.17 g/mol, XLogP of 11.11, 25 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59968219 is sourced from PubChem (CID 59968219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).